C21H24N4O — CID 108885753
1-(2,3-dimethylquinoxalin-6-yl)-3-(4-phenylbutyl)urea (PubChem CID 108885753) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-(2,3-dimethylquinoxalin-6-yl)-3-(4-phenylbutyl)urea.
| Compound Name | 1-(2,3-dimethylquinoxalin-6-yl)-3-(4-phenylbutyl)urea |
|---|---|
| PubChem CID | 108885753 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-(2,3-dimethylquinoxalin-6-yl)-3-(4-phenylbutyl)urea |
| SMILES | Cc1nc2ccc(NC(=O)NCCCCc3ccccc3)cc2nc1C |
| InChI | InChI=1S/C21H24N4O/c1-15-16(2)24-20-14-18(11-12-19(20)23-15)25-21(26)22-13-7-6-10-17-8-4-3-5-9-17/h3-5,8-9,11-12,14H,6-7,10,13H2,1-2H3,(H2,22,25,26) |
| InChIKey | MTFYNRZHAJIRFC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|