C19H19ClN4O — CID 108885740
1-[2-(3-chlorophenyl)ethyl]-3-(2,3-dimethylquinoxalin-6-yl)urea (PubChem CID 108885740) has the molecular formula C19H19ClN4O and a molecular weight of 354.84 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-(2,3-dimethylquinoxalin-6-yl)urea.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-(2,3-dimethylquinoxalin-6-yl)urea |
|---|---|
| PubChem CID | 108885740 |
| Molecular Formula | C19H19ClN4O |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-(2,3-dimethylquinoxalin-6-yl)urea |
| SMILES | Cc1nc2ccc(NC(=O)NCCc3cccc(Cl)c3)cc2nc1C |
| InChI | InChI=1S/C19H19ClN4O/c1-12-13(2)23-18-11-16(6-7-17(18)22-12)24-19(25)21-9-8-14-4-3-5-15(20)10-14/h3-7,10-11H,8-9H2,1-2H3,(H2,21,24,25) |
| InChIKey | LCBUOJUPVRFDEL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |