C21H21N5O — CID 108885678
1-(2,3-dimethylquinoxalin-6-yl)-3-[2-(1H-indol-3-yl)ethyl]urea (PubChem CID 108885678) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-(2,3-dimethylquinoxalin-6-yl)-3-[2-(1H-indol-3-yl)ethyl]urea.
| Compound Name | 1-(2,3-dimethylquinoxalin-6-yl)-3-[2-(1H-indol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 108885678 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 1-(2,3-dimethylquinoxalin-6-yl)-3-[2-(1H-indol-3-yl)ethyl]urea |
| SMILES | Cc1nc2ccc(NC(=O)NCCc3c[nH]c4ccccc34)cc2nc1C |
| InChI | InChI=1S/C21H21N5O/c1-13-14(2)25-20-11-16(7-8-19(20)24-13)26-21(27)22-10-9-15-12-23-18-6-4-3-5-17(15)18/h3-8,11-12,23H,9-10H2,1-2H3,(H2,22,26,27) |
| InChIKey | HHDRYVIIWFBJAD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |