C19H20N4O3 — CID 51118943
methyl N-[3-[2-(1H-indol-3-yl)ethylcarbamoylamino]phenyl]carbamate (PubChem CID 51118943) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is methyl N-[3-[2-(1H-indol-3-yl)ethylcarbamoylamino]phenyl]carbamate.
| Compound Name | methyl N-[3-[2-(1H-indol-3-yl)ethylcarbamoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 51118943 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | methyl N-[3-[2-(1H-indol-3-yl)ethylcarbamoylamino]phenyl]carbamate |
| SMILES | COC(=O)Nc1cccc(NC(=O)NCCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C19H20N4O3/c1-26-19(25)23-15-6-4-5-14(11-15)22-18(24)20-10-9-13-12-21-17-8-3-2-7-16(13)17/h2-8,11-12,21H,9-10H2,1H3,(H,23,25)(H2,20,22,24) |
| InChIKey | IZQIQCWUIAJUNE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |