C17H15Br2N3O — CID 155514959
1-(3,5-dibromophenyl)-3-[2-(1H-indol-3-yl)ethyl]urea (PubChem CID 155514959) has the molecular formula C17H15Br2N3O and a molecular weight of 437.14 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)-3-[2-(1H-indol-3-yl)ethyl]urea.
| Compound Name | 1-(3,5-dibromophenyl)-3-[2-(1H-indol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 155514959 |
| Molecular Formula | C17H15Br2N3O |
| Molecular Weight | 437.14 g/mol |
| Exact Mass | 434.96 |
| IUPAC Name | 1-(3,5-dibromophenyl)-3-[2-(1H-indol-3-yl)ethyl]urea |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)Nc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C17H15Br2N3O/c18-12-7-13(19)9-14(8-12)22-17(23)20-6-5-11-10-21-16-4-2-1-3-15(11)16/h1-4,7-10,21H,5-6H2,(H2,20,22,23) |
| InChIKey | HBDAFIXWSNWUAZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.14 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |