C17H17N3O4 — CID 108871937
1-[2-(1H-indol-3-yl)ethyl]-3-(3,4,5-trihydroxyphenyl)urea (PubChem CID 108871937) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethyl]-3-(3,4,5-trihydroxyphenyl)urea.
| Compound Name | 1-[2-(1H-indol-3-yl)ethyl]-3-(3,4,5-trihydroxyphenyl)urea |
|---|---|
| PubChem CID | 108871937 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethyl]-3-(3,4,5-trihydroxyphenyl)urea |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)Nc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C17H17N3O4/c21-14-7-11(8-15(22)16(14)23)20-17(24)18-6-5-10-9-19-13-4-2-1-3-12(10)13/h1-4,7-9,19,21-23H,5-6H2,(H2,18,20,24) |
| InChIKey | ULCTUIAYCFMZLH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|