C16H14ClN3OS — CID 41435752
1-(1,3-benzothiazol-2-yl)-3-[2-(3-chlorophenyl)ethyl]urea (PubChem CID 41435752) has the molecular formula C16H14ClN3OS and a molecular weight of 331.83 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-[2-(3-chlorophenyl)ethyl]urea.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-[2-(3-chlorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 41435752 |
| Molecular Formula | C16H14ClN3OS |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-[2-(3-chlorophenyl)ethyl]urea |
| SMILES | O=C(NCCc1cccc(Cl)c1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H14ClN3OS/c17-12-5-3-4-11(10-12)8-9-18-15(21)20-16-19-13-6-1-2-7-14(13)22-16/h1-7,10H,8-9H2,(H2,18,19,20,21) |
| InChIKey | BOASCJWZMFKOIL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |