C22H25Cl2N5OS — CID 142413686
1-(1,3-benzothiazol-2-yl)-3-[4-[4-(2,4-dichlorophenyl)piperazin-1-yl]butyl]urea (PubChem CID 142413686) has the molecular formula C22H25Cl2N5OS and a molecular weight of 478.45 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-[4-[4-(2,4-dichlorophenyl)piperazin-1-yl]butyl]urea.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-[4-[4-(2,4-dichlorophenyl)piperazin-1-yl]butyl]urea |
|---|---|
| PubChem CID | 142413686 |
| Molecular Formula | C22H25Cl2N5OS |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-[4-[4-(2,4-dichlorophenyl)piperazin-1-yl]butyl]urea |
| SMILES | O=C(NCCCCN1CCN(c2ccc(Cl)cc2Cl)CC1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C22H25Cl2N5OS/c23-16-7-8-19(17(24)15-16)29-13-11-28(12-14-29)10-4-3-9-25-21(30)27-22-26-18-5-1-2-6-20(18)31-22/h1-2,5-8,15H,3-4,9-14H2,(H2,25,26,27,30) |
| InChIKey | XKTMAMAOZMDLHG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|