C17H27N3O4SSi — CID 59228635
1-(1,3-benzothiazol-2-yl)-3-(3-triethoxysilylpropyl)urea (PubChem CID 59228635) has the molecular formula C17H27N3O4SSi and a molecular weight of 397.57 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-(3-triethoxysilylpropyl)urea.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-(3-triethoxysilylpropyl)urea |
|---|---|
| PubChem CID | 59228635 |
| Molecular Formula | C17H27N3O4SSi |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-(3-triethoxysilylpropyl)urea |
| SMILES | CCO[Si](CCCNC(=O)Nc1nc2ccccc2s1)(OCC)OCC |
| InChI | InChI=1S/C17H27N3O4SSi/c1-4-22-26(23-5-2,24-6-3)13-9-12-18-16(21)20-17-19-14-10-7-8-11-15(14)25-17/h7-8,10-11H,4-6,9,12-13H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | MOOUJIPOWOWLRA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|