1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen

C9H13N3OS — CID 143832534

IUPAC1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen
SMILESCNC(=O)Nc1nc2ccccc2s1.[H][H].[H][H]
InChIInChI=1S/C9H9N3OS.2H2/c1-10-8(13)12-9-11-6-4-2-3-5-7(6)14-9;;/h2-5H,1H3,(H2,10,11,12,13);2*1H
InChIKeyLFLOVKLDWFPXBT-UHFFFAOYSA-N
MW211.29 g/mol
LogP2.54
Rot. Bonds1

About 1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen

1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen (PubChem CID 143832534) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen.

Molecular Properties

Compound Name1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen
PubChem CID143832534
Molecular FormulaC9H13N3OS
Molecular Weight211.29 g/mol
Exact Mass211.08
IUPAC Name1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen
SMILESCNC(=O)Nc1nc2ccccc2s1.[H][H].[H][H]
InChIInChI=1S/C9H9N3OS.2H2/c1-10-8(13)12-9-11-6-4-2-3-5-7(6)14-9;;/h2-5H,1H3,(H2,10,11,12,13);2*1H
InChIKeyLFLOVKLDWFPXBT-UHFFFAOYSA-N
XLogP2.54
TPSA54.02 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.29
LogP ≤ 52.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen?
The IUPAC name of 1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen (CID 143832534) is 1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen.
What is the SMILES notation for 1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen?
The canonical SMILES for 1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen is CNC(=O)Nc1nc2ccccc2s1.[H][H].[H][H].
What is the InChIKey of 1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen?
The InChIKey is LFLOVKLDWFPXBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3OS.2H2/c1-10-8(13)12-9-11-6-4-2-3-5-7(6)14-9;;/h2-5H,1H3,(H2,10,11,12,13);2*1H.
What are the key properties of 1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen?
1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen has a molecular weight of 211.29 g/mol, XLogP of 2.54, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen is sourced from PubChem (CID 143832534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).