C9H13N3OS — CID 143832534
1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen (PubChem CID 143832534) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen |
|---|---|
| PubChem CID | 143832534 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-methylurea;molecular hydrogen |
| SMILES | CNC(=O)Nc1nc2ccccc2s1.[H][H].[H][H] |
| InChI | InChI=1S/C9H9N3OS.2H2/c1-10-8(13)12-9-11-6-4-2-3-5-7(6)14-9;;/h2-5H,1H3,(H2,10,11,12,13);2*1H |
| InChIKey | LFLOVKLDWFPXBT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |