C9H9N3OS — CID 163322182
1-(1,3-benzothiazol-2-yl)-3-(trideuteriomethyl)urea (PubChem CID 163322182) has the molecular formula C9H9N3OS and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-(trideuteriomethyl)urea.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-(trideuteriomethyl)urea |
|---|---|
| PubChem CID | 163322182 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-(trideuteriomethyl)urea |
| SMILES | [2H]C([2H])([2H])NC(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H9N3OS/c1-10-8(13)12-9-11-6-4-2-3-5-7(6)14-9/h2-5H,1H3,(H2,10,11,12,13)/i1D3 |
| InChIKey | DTCJYIIKPVRVDD-FIBGUPNXSA-N |
| XLogP | 2.05 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |