C15H11N3O3S — CID 165368088
2-(1,3-benzothiazol-2-ylcarbamoylamino)benzoic acid (PubChem CID 165368088) has the molecular formula C15H11N3O3S and a molecular weight of 313.34 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylcarbamoylamino)benzoic acid.
| Compound Name | 2-(1,3-benzothiazol-2-ylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 165368088 |
| Molecular Formula | C15H11N3O3S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylcarbamoylamino)benzoic acid |
| SMILES | O=C(Nc1nc2ccccc2s1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C15H11N3O3S/c19-13(20)9-5-1-2-6-10(9)16-14(21)18-15-17-11-7-3-4-8-12(11)22-15/h1-8H,(H,19,20)(H2,16,17,18,21) |
| InChIKey | XHCYTCXUQHHYQV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |