C14H12N4O3S2 — CID 165368097
1-(1,3-benzothiazol-2-yl)-3-(2-sulfamoylphenyl)urea (PubChem CID 165368097) has the molecular formula C14H12N4O3S2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-(2-sulfamoylphenyl)urea.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-(2-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 165368097 |
| Molecular Formula | C14H12N4O3S2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-(2-sulfamoylphenyl)urea |
| SMILES | NS(=O)(=O)c1ccccc1NC(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H12N4O3S2/c15-23(20,21)12-8-4-2-6-10(12)16-13(19)18-14-17-9-5-1-3-7-11(9)22-14/h1-8H,(H2,15,20,21)(H2,16,17,18,19) |
| InChIKey | GZRBNBMVMKRASJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |