C15H14N4O3S2 — CID 41364793
1-(1,3-benzothiazol-2-yl)-3-[(4-sulfamoylphenyl)methyl]urea (PubChem CID 41364793) has the molecular formula C15H14N4O3S2 and a molecular weight of 362.44 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-[(4-sulfamoylphenyl)methyl]urea.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-[(4-sulfamoylphenyl)methyl]urea |
|---|---|
| PubChem CID | 41364793 |
| Molecular Formula | C15H14N4O3S2 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-[(4-sulfamoylphenyl)methyl]urea |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)Nc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C15H14N4O3S2/c16-24(21,22)11-7-5-10(6-8-11)9-17-14(20)19-15-18-12-3-1-2-4-13(12)23-15/h1-8H,9H2,(H2,16,21,22)(H2,17,18,19,20) |
| InChIKey | BYJWPNVUXBJUNE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |