C17H15N3O3S — CID 4785409
N-[(4-sulfamoylphenyl)methyl]quinoline-2-carboxamide (PubChem CID 4785409) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is N-[(4-sulfamoylphenyl)methyl]quinoline-2-carboxamide.
| Compound Name | N-[(4-sulfamoylphenyl)methyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 4785409 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | N-[(4-sulfamoylphenyl)methyl]quinoline-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)c2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C17H15N3O3S/c18-24(22,23)14-8-5-12(6-9-14)11-19-17(21)16-10-7-13-3-1-2-4-15(13)20-16/h1-10H,11H2,(H,19,21)(H2,18,22,23) |
| InChIKey | WFDUUVQMEYMIMC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |