C17H12ClFN2O — CID 71822257
N-[(3-chloro-4-fluorophenyl)methyl]quinoline-2-carboxamide (PubChem CID 71822257) has the molecular formula C17H12ClFN2O and a molecular weight of 314.75 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]quinoline-2-carboxamide.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 71822257 |
| Molecular Formula | C17H12ClFN2O |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]quinoline-2-carboxamide |
| SMILES | O=C(NCc1ccc(F)c(Cl)c1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C17H12ClFN2O/c18-13-9-11(5-7-14(13)19)10-20-17(22)16-8-6-12-3-1-2-4-15(12)21-16/h1-9H,10H2,(H,20,22) |
| InChIKey | HJJDEUPJPMLYRX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |