C12H9ClFN3O2 — CID 110794473
N-[(3-chloro-4-fluorophenyl)methyl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 110794473) has the molecular formula C12H9ClFN3O2 and a molecular weight of 281.67 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 110794473 |
| Molecular Formula | C12H9ClFN3O2 |
| Molecular Weight | 281.67 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)c(Cl)c1)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C12H9ClFN3O2/c13-8-5-7(1-2-9(8)14)6-15-12(19)10-3-4-11(18)17-16-10/h1-5H,6H2,(H,15,19)(H,17,18) |
| InChIKey | XENVQNMLEQMAJJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.67 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |