C13H10ClFN2O2 — CID 46921250
N-[(3-chloro-4-fluorophenyl)methyl]-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 46921250) has the molecular formula C13H10ClFN2O2 and a molecular weight of 280.69 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46921250 |
| Molecular Formula | C13H10ClFN2O2 |
| Molecular Weight | 280.69 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)c(Cl)c1)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C13H10ClFN2O2/c14-10-5-8(1-3-11(10)15)6-17-13(19)9-2-4-12(18)16-7-9/h1-5,7H,6H2,(H,16,18)(H,17,19) |
| InChIKey | AQJLITHIJHZTDJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.69 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |