C14H13ClN2O2 — CID 114040983
N-[[3-(chloromethyl)phenyl]methyl]-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 114040983) has the molecular formula C14H13ClN2O2 and a molecular weight of 276.72 g/mol. Its IUPAC name is N-[[3-(chloromethyl)phenyl]methyl]-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[[3-(chloromethyl)phenyl]methyl]-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 114040983 |
| Molecular Formula | C14H13ClN2O2 |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | N-[[3-(chloromethyl)phenyl]methyl]-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCc1cccc(CCl)c1)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C14H13ClN2O2/c15-7-10-2-1-3-11(6-10)8-17-14(19)12-4-5-13(18)16-9-12/h1-6,9H,7-8H2,(H,16,18)(H,17,19) |
| InChIKey | SNARTEGPNHOUAK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|