C15H12ClF2NO — CID 114302295
N-[[3-(chloromethyl)phenyl]methyl]-3,4-difluorobenzamide (PubChem CID 114302295) has the molecular formula C15H12ClF2NO and a molecular weight of 295.72 g/mol. Its IUPAC name is N-[[3-(chloromethyl)phenyl]methyl]-3,4-difluorobenzamide.
| Compound Name | N-[[3-(chloromethyl)phenyl]methyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 114302295 |
| Molecular Formula | C15H12ClF2NO |
| Molecular Weight | 295.72 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-[[3-(chloromethyl)phenyl]methyl]-3,4-difluorobenzamide |
| SMILES | O=C(NCc1cccc(CCl)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H12ClF2NO/c16-8-10-2-1-3-11(6-10)9-19-15(20)12-4-5-13(17)14(18)7-12/h1-7H,8-9H2,(H,19,20) |
| InChIKey | MCCCSIYJFUXVPO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.72 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|