C14H10ClF2NO — CID 114293187
N-[3-(chloromethyl)phenyl]-3,4-difluorobenzamide (PubChem CID 114293187) has the molecular formula C14H10ClF2NO and a molecular weight of 281.69 g/mol. Its IUPAC name is N-[3-(chloromethyl)phenyl]-3,4-difluorobenzamide.
| Compound Name | N-[3-(chloromethyl)phenyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 114293187 |
| Molecular Formula | C14H10ClF2NO |
| Molecular Weight | 281.69 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | N-[3-(chloromethyl)phenyl]-3,4-difluorobenzamide |
| SMILES | O=C(Nc1cccc(CCl)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H10ClF2NO/c15-8-9-2-1-3-11(6-9)18-14(19)10-4-5-12(16)13(17)7-10/h1-7H,8H2,(H,18,19) |
| InChIKey | PLDWXFGSADPBQT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.69 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|