C14H9BrClF2NO — CID 114293310
4-bromo-N-[3-(chloromethyl)phenyl]-2,6-difluorobenzamide (PubChem CID 114293310) has the molecular formula C14H9BrClF2NO and a molecular weight of 360.59 g/mol. Its IUPAC name is 4-bromo-N-[3-(chloromethyl)phenyl]-2,6-difluorobenzamide.
| Compound Name | 4-bromo-N-[3-(chloromethyl)phenyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 114293310 |
| Molecular Formula | C14H9BrClF2NO |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | 4-bromo-N-[3-(chloromethyl)phenyl]-2,6-difluorobenzamide |
| SMILES | O=C(Nc1cccc(CCl)c1)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C14H9BrClF2NO/c15-9-5-11(17)13(12(18)6-9)14(20)19-10-3-1-2-8(4-10)7-16/h1-6H,7H2,(H,19,20) |
| InChIKey | SSESDAFIKYJEMT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|