C15H13ClFNO2 — CID 107231671
3-chloro-4-fluoro-N-[[4-(hydroxymethyl)phenyl]methyl]benzamide (PubChem CID 107231671) has the molecular formula C15H13ClFNO2 and a molecular weight of 293.73 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-[[4-(hydroxymethyl)phenyl]methyl]benzamide.
| Compound Name | 3-chloro-4-fluoro-N-[[4-(hydroxymethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 107231671 |
| Molecular Formula | C15H13ClFNO2 |
| Molecular Weight | 293.73 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 3-chloro-4-fluoro-N-[[4-(hydroxymethyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(CO)cc1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H13ClFNO2/c16-13-7-12(5-6-14(13)17)15(20)18-8-10-1-3-11(9-19)4-2-10/h1-7,19H,8-9H2,(H,18,20) |
| InChIKey | BOCGPHOTPYULAJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.73 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |