C10H8BrN3O2S — CID 38637755
N-[(5-bromothiophen-3-yl)methyl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 38637755) has the molecular formula C10H8BrN3O2S and a molecular weight of 314.16 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 38637755 |
| Molecular Formula | C10H8BrN3O2S |
| Molecular Weight | 314.16 g/mol |
| Exact Mass | 312.95 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | O=C(NCc1csc(Br)c1)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C10H8BrN3O2S/c11-8-3-6(5-17-8)4-12-10(16)7-1-2-9(15)14-13-7/h1-3,5H,4H2,(H,12,16)(H,14,15) |
| InChIKey | FGCVNFPIECPCJY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.16 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |