C13H11Cl2N3O3S — CID 84580537
2,6-dichloro-N-[(4-sulfamoylphenyl)methyl]pyridine-4-carboxamide (PubChem CID 84580537) has the molecular formula C13H11Cl2N3O3S and a molecular weight of 360.22 g/mol. Its IUPAC name is 2,6-dichloro-N-[(4-sulfamoylphenyl)methyl]pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-[(4-sulfamoylphenyl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 84580537 |
| Molecular Formula | C13H11Cl2N3O3S |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 2,6-dichloro-N-[(4-sulfamoylphenyl)methyl]pyridine-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)c2cc(Cl)nc(Cl)c2)cc1 |
| InChI | InChI=1S/C13H11Cl2N3O3S/c14-11-5-9(6-12(15)18-11)13(19)17-7-8-1-3-10(4-2-8)22(16,20)21/h1-6H,7H2,(H,17,19)(H2,16,20,21) |
| InChIKey | IGRUFBKFLUQXQU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|