C15H16ClN3O4S — CID 84576032
2-chloro-6-methoxy-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-4-carboxamide (PubChem CID 84576032) has the molecular formula C15H16ClN3O4S and a molecular weight of 369.83 g/mol. Its IUPAC name is 2-chloro-6-methoxy-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-6-methoxy-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 84576032 |
| Molecular Formula | C15H16ClN3O4S |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 2-chloro-6-methoxy-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-4-carboxamide |
| SMILES | COc1cc(C(=O)NCCc2ccc(S(N)(=O)=O)cc2)cc(Cl)n1 |
| InChI | InChI=1S/C15H16ClN3O4S/c1-23-14-9-11(8-13(16)19-14)15(20)18-7-6-10-2-4-12(5-3-10)24(17,21)22/h2-5,8-9H,6-7H2,1H3,(H,18,20)(H2,17,21,22) |
| InChIKey | OBRAEQDOYAMGEL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|