C18H20ClN3O5S — CID 17257152
4-acetamido-5-chloro-2-methoxy-N-[2-(4-sulfamoylphenyl)ethyl]benzamide (PubChem CID 17257152) has the molecular formula C18H20ClN3O5S and a molecular weight of 425.89 g/mol. Its IUPAC name is 4-acetamido-5-chloro-2-methoxy-N-[2-(4-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | 4-acetamido-5-chloro-2-methoxy-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 17257152 |
| Molecular Formula | C18H20ClN3O5S |
| Molecular Weight | 425.89 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 4-acetamido-5-chloro-2-methoxy-N-[2-(4-sulfamoylphenyl)ethyl]benzamide |
| SMILES | COc1cc(NC(C)=O)c(Cl)cc1C(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H20ClN3O5S/c1-11(23)22-16-10-17(27-2)14(9-15(16)19)18(24)21-8-7-12-3-5-13(6-4-12)28(20,25)26/h3-6,9-10H,7-8H2,1-2H3,(H,21,24)(H,22,23)(H2,20,25,26) |
| InChIKey | DECNXACSBBQUIO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.89 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |