C18H20ClNO6S — CID 154181600
4-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]benzenesulfonyl chloride (PubChem CID 154181600) has the molecular formula C18H20ClNO6S and a molecular weight of 413.88 g/mol. Its IUPAC name is 4-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]benzenesulfonyl chloride.
| Compound Name | 4-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 154181600 |
| Molecular Formula | C18H20ClNO6S |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 4-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]benzenesulfonyl chloride |
| SMILES | COc1cc(C(=O)NCCc2ccc(S(=O)(=O)Cl)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C18H20ClNO6S/c1-24-15-10-13(11-16(25-2)17(15)26-3)18(21)20-9-8-12-4-6-14(7-5-12)27(19,22)23/h4-7,10-11H,8-9H2,1-3H3,(H,20,21) |
| InChIKey | SAJLLULZPJIUMU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |