C19H21N3O4 — CID 146025489
N-[2-(3,4,5-trimethoxyphenyl)ethyl]-3H-benzimidazole-5-carboxamide (PubChem CID 146025489) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is N-[2-(3,4,5-trimethoxyphenyl)ethyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[2-(3,4,5-trimethoxyphenyl)ethyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 146025489 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[2-(3,4,5-trimethoxyphenyl)ethyl]-3H-benzimidazole-5-carboxamide |
| SMILES | COc1cc(CCNC(=O)c2ccc3nc[nH]c3c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H21N3O4/c1-24-16-8-12(9-17(25-2)18(16)26-3)6-7-20-19(23)13-4-5-14-15(10-13)22-11-21-14/h4-5,8-11H,6-7H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | KPVVTJNEJNHEDR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |