C22H25N3O2 — CID 129168538
N-[3-[(1R)-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]propyl]-3H-benzimidazole-5-carboxamide (PubChem CID 129168538) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-[3-[(1R)-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]propyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[3-[(1R)-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]propyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 129168538 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | N-[3-[(1R)-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]propyl]-3H-benzimidazole-5-carboxamide |
| SMILES | COc1cccc2c1CCC[C@@H]2CCCNC(=O)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C22H25N3O2/c1-27-21-9-3-7-17-15(5-2-8-18(17)21)6-4-12-23-22(26)16-10-11-19-20(13-16)25-14-24-19/h3,7,9-11,13-15H,2,4-6,8,12H2,1H3,(H,23,26)(H,24,25)/t15-/m1/s1 |
| InChIKey | MBIWCTKJLWWHGP-OAHLLOKOSA-N |
| XLogP | 4.20 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|