C12H17ClN4O — CID 162475318
N-(4-aminobutyl)-3H-benzimidazole-5-carboxamide;hydrochloride (PubChem CID 162475318) has the molecular formula C12H17ClN4O and a molecular weight of 268.75 g/mol. Its IUPAC name is N-(4-aminobutyl)-3H-benzimidazole-5-carboxamide;hydrochloride.
| Compound Name | N-(4-aminobutyl)-3H-benzimidazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 162475318 |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | N-(4-aminobutyl)-3H-benzimidazole-5-carboxamide;hydrochloride |
| SMILES | Cl.NCCCCNC(=O)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C12H16N4O.ClH/c13-5-1-2-6-14-12(17)9-3-4-10-11(7-9)16-8-15-10;/h3-4,7-8H,1-2,5-6,13H2,(H,14,17)(H,15,16);1H |
| InChIKey | LYLREUBRJPOUDA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|