C17H13F3N4O2 — CID 108542173
N-[2-[(2,3,4-trifluorobenzoyl)amino]ethyl]-3H-benzimidazole-5-carboxamide (PubChem CID 108542173) has the molecular formula C17H13F3N4O2 and a molecular weight of 362.31 g/mol. Its IUPAC name is N-[2-[(2,3,4-trifluorobenzoyl)amino]ethyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[2-[(2,3,4-trifluorobenzoyl)amino]ethyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 108542173 |
| Molecular Formula | C17H13F3N4O2 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N-[2-[(2,3,4-trifluorobenzoyl)amino]ethyl]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(NCCNC(=O)c1ccc(F)c(F)c1F)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C17H13F3N4O2/c18-11-3-2-10(14(19)15(11)20)17(26)22-6-5-21-16(25)9-1-4-12-13(7-9)24-8-23-12/h1-4,7-8H,5-6H2,(H,21,25)(H,22,26)(H,23,24) |
| InChIKey | FYUNKMAFGNFQLQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|