C16H15ClN4O3S — CID 108573390
N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-3H-benzimidazole-5-carboxamide (PubChem CID 108573390) has the molecular formula C16H15ClN4O3S and a molecular weight of 378.84 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 108573390 |
| Molecular Formula | C16H15ClN4O3S |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | N-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(NCCNS(=O)(=O)c1ccc(Cl)cc1)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C16H15ClN4O3S/c17-12-2-4-13(5-3-12)25(23,24)21-8-7-18-16(22)11-1-6-14-15(9-11)20-10-19-14/h1-6,9-10,21H,7-8H2,(H,18,22)(H,19,20) |
| InChIKey | HZTFVIDICQUJKX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|