C23H27N3O2 — CID 129168649
N-[3-[(1S)-7-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]propyl]-3H-benzimidazole-5-carboxamide (PubChem CID 129168649) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-[3-[(1S)-7-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]propyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[3-[(1S)-7-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]propyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 129168649 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-[3-[(1S)-7-methoxy-2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]propyl]-3H-benzimidazole-5-carboxamide |
| SMILES | COc1ccc2c(c1)[C@@H](CCCNC(=O)c1ccc3nc[nH]c3c1)C(C)CC2 |
| InChI | InChI=1S/C23H27N3O2/c1-15-5-6-16-7-9-18(28-2)13-20(16)19(15)4-3-11-24-23(27)17-8-10-21-22(12-17)26-14-25-21/h7-10,12-15,19H,3-6,11H2,1-2H3,(H,24,27)(H,25,26)/t15?,19-/m0/s1 |
| InChIKey | ZDYQTLRFSLKTFU-FUBQLUNQSA-N |
| XLogP | 4.45 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|