C16H15N3O3S2 — CID 28934838
2-methyl-N-[(4-sulfamoylphenyl)methyl]-1,3-benzothiazole-6-carboxamide (PubChem CID 28934838) has the molecular formula C16H15N3O3S2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 2-methyl-N-[(4-sulfamoylphenyl)methyl]-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-methyl-N-[(4-sulfamoylphenyl)methyl]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 28934838 |
| Molecular Formula | C16H15N3O3S2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 2-methyl-N-[(4-sulfamoylphenyl)methyl]-1,3-benzothiazole-6-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)NCc3ccc(S(N)(=O)=O)cc3)cc2s1 |
| InChI | InChI=1S/C16H15N3O3S2/c1-10-19-14-7-4-12(8-15(14)23-10)16(20)18-9-11-2-5-13(6-3-11)24(17,21)22/h2-8H,9H2,1H3,(H,18,20)(H2,17,21,22) |
| InChIKey | JFRMLWXTXGJCRB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |