C11H12N2O3S2 — CID 145100847
2-[(2-methyl-1,3-benzothiazole-6-carbonyl)amino]ethanesulfinic acid (PubChem CID 145100847) has the molecular formula C11H12N2O3S2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-benzothiazole-6-carbonyl)amino]ethanesulfinic acid.
| Compound Name | 2-[(2-methyl-1,3-benzothiazole-6-carbonyl)amino]ethanesulfinic acid |
|---|---|
| PubChem CID | 145100847 |
| Molecular Formula | C11H12N2O3S2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 2-[(2-methyl-1,3-benzothiazole-6-carbonyl)amino]ethanesulfinic acid |
| SMILES | Cc1nc2ccc(C(=O)NCCS(=O)O)cc2s1 |
| InChI | InChI=1S/C11H12N2O3S2/c1-7-13-9-3-2-8(6-10(9)17-7)11(14)12-4-5-18(15)16/h2-3,6H,4-5H2,1H3,(H,12,14)(H,15,16) |
| InChIKey | GTOVFWLGJCBTEK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|