C15H18N2O3S — CID 126451493
(3R)-3-[(2-methyl-1,3-benzothiazole-6-carbonyl)amino]hexanoic acid (PubChem CID 126451493) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is (3R)-3-[(2-methyl-1,3-benzothiazole-6-carbonyl)amino]hexanoic acid.
| Compound Name | (3R)-3-[(2-methyl-1,3-benzothiazole-6-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 126451493 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (3R)-3-[(2-methyl-1,3-benzothiazole-6-carbonyl)amino]hexanoic acid |
| SMILES | CCC[C@H](CC(=O)O)NC(=O)c1ccc2nc(C)sc2c1 |
| InChI | InChI=1S/C15H18N2O3S/c1-3-4-11(8-14(18)19)17-15(20)10-5-6-12-13(7-10)21-9(2)16-12/h5-7,11H,3-4,8H2,1-2H3,(H,17,20)(H,18,19)/t11-/m1/s1 |
| InChIKey | IDPIIHBBQCQQAK-LLVKDONJSA-N |
| XLogP | 2.98 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |