C11H16N2O3S — CID 97328202
(3S)-3-[(2-methyl-1,3-thiazole-4-carbonyl)amino]hexanoic acid (PubChem CID 97328202) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is (3S)-3-[(2-methyl-1,3-thiazole-4-carbonyl)amino]hexanoic acid.
| Compound Name | (3S)-3-[(2-methyl-1,3-thiazole-4-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 97328202 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (3S)-3-[(2-methyl-1,3-thiazole-4-carbonyl)amino]hexanoic acid |
| SMILES | CCC[C@@H](CC(=O)O)NC(=O)c1csc(C)n1 |
| InChI | InChI=1S/C11H16N2O3S/c1-3-4-8(5-10(14)15)13-11(16)9-6-17-7(2)12-9/h6,8H,3-5H2,1-2H3,(H,13,16)(H,14,15)/t8-/m0/s1 |
| InChIKey | ASBATHNNMOJLQD-QMMMGPOBSA-N |
| XLogP | 1.82 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |