C10H12N2O5S — CID 65199559
(2S)-2-[(2-methyl-1,3-thiazole-4-carbonyl)amino]pentanedioic acid (PubChem CID 65199559) has the molecular formula C10H12N2O5S and a molecular weight of 272.28 g/mol. Its IUPAC name is (2S)-2-[(2-methyl-1,3-thiazole-4-carbonyl)amino]pentanedioic acid.
| Compound Name | (2S)-2-[(2-methyl-1,3-thiazole-4-carbonyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 65199559 |
| Molecular Formula | C10H12N2O5S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | (2S)-2-[(2-methyl-1,3-thiazole-4-carbonyl)amino]pentanedioic acid |
| SMILES | Cc1nc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cs1 |
| InChI | InChI=1S/C10H12N2O5S/c1-5-11-7(4-18-5)9(15)12-6(10(16)17)2-3-8(13)14/h4,6H,2-3H2,1H3,(H,12,15)(H,13,14)(H,16,17)/t6-/m0/s1 |
| InChIKey | JIHJIPKMQQLPHK-LURJTMIESA-N |
| XLogP | 0.50 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |