C17H17N3O7S — CID 84555720
2-[[2-[(4-methoxybenzoyl)amino]-1,3-thiazole-4-carbonyl]amino]pentanedioic acid (PubChem CID 84555720) has the molecular formula C17H17N3O7S and a molecular weight of 407.40 g/mol. Its IUPAC name is 2-[[2-[(4-methoxybenzoyl)amino]-1,3-thiazole-4-carbonyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[(4-methoxybenzoyl)amino]-1,3-thiazole-4-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 84555720 |
| Molecular Formula | C17H17N3O7S |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 2-[[2-[(4-methoxybenzoyl)amino]-1,3-thiazole-4-carbonyl]amino]pentanedioic acid |
| SMILES | COc1ccc(C(=O)Nc2nc(C(=O)NC(CCC(=O)O)C(=O)O)cs2)cc1 |
| InChI | InChI=1S/C17H17N3O7S/c1-27-10-4-2-9(3-5-10)14(23)20-17-19-12(8-28-17)15(24)18-11(16(25)26)6-7-13(21)22/h2-5,8,11H,6-7H2,1H3,(H,18,24)(H,21,22)(H,25,26)(H,19,20,23) |
| InChIKey | SAIPGJJOJXTPDC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 154.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |