C8H9N3O5S — CID 61153025
(2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid (PubChem CID 61153025) has the molecular formula C8H9N3O5S and a molecular weight of 259.24 g/mol. Its IUPAC name is (2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid.
| Compound Name | (2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid |
|---|---|
| PubChem CID | 61153025 |
| Molecular Formula | C8H9N3O5S |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | (2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)c1cnsn1)C(=O)O |
| InChI | InChI=1S/C8H9N3O5S/c12-6(13)2-1-4(8(15)16)10-7(14)5-3-9-17-11-5/h3-4H,1-2H2,(H,10,14)(H,12,13)(H,15,16)/t4-/m0/s1 |
| InChIKey | SYJCRCOFEHZTPD-BYPYZUCNSA-N |
| XLogP | -0.41 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |