(2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid

C8H9N3O5S — CID 61153025

IUPAC(2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid
SMILESO=C(O)CC[C@H](NC(=O)c1cnsn1)C(=O)O
InChIInChI=1S/C8H9N3O5S/c12-6(13)2-1-4(8(15)16)10-7(14)5-3-9-17-11-5/h3-4H,1-2H2,(H,10,14)(H,12,13)(H,15,16)/t4-/m0/s1
InChIKeySYJCRCOFEHZTPD-BYPYZUCNSA-N
MW259.24 g/mol
LogP-0.41
Rot. Bonds6

About (2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid

(2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid (PubChem CID 61153025) has the molecular formula C8H9N3O5S and a molecular weight of 259.24 g/mol. Its IUPAC name is (2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid.

Molecular Properties

Compound Name(2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid
PubChem CID61153025
Molecular FormulaC8H9N3O5S
Molecular Weight259.24 g/mol
Exact Mass259.03
IUPAC Name(2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid
SMILESO=C(O)CC[C@H](NC(=O)c1cnsn1)C(=O)O
InChIInChI=1S/C8H9N3O5S/c12-6(13)2-1-4(8(15)16)10-7(14)5-3-9-17-11-5/h3-4H,1-2H2,(H,10,14)(H,12,13)(H,15,16)/t4-/m0/s1
InChIKeySYJCRCOFEHZTPD-BYPYZUCNSA-N
XLogP-0.41
TPSA129.48 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.24
LogP ≤ 5-0.41
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Analyze (2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid?
The IUPAC name of (2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid (CID 61153025) is (2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid.
What is the SMILES notation for (2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid?
The canonical SMILES for (2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid is O=C(O)CC[C@H](NC(=O)c1cnsn1)C(=O)O.
What is the InChIKey of (2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid?
The InChIKey is SYJCRCOFEHZTPD-BYPYZUCNSA-N. The full InChI is InChI=1S/C8H9N3O5S/c12-6(13)2-1-4(8(15)16)10-7(14)5-3-9-17-11-5/h3-4H,1-2H2,(H,10,14)(H,12,13)(H,15,16)/t4-/m0/s1.
What are the key properties of (2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid?
(2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid has a molecular weight of 259.24 g/mol, XLogP of -0.41, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(1,2,5-thiadiazole-3-carbonylamino)pentanedioic acid is sourced from PubChem (CID 61153025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).