C9H11N3O5S — CID 114006173
(2R)-2-(thiadiazole-4-carbonylamino)hexanedioic acid (PubChem CID 114006173) has the molecular formula C9H11N3O5S and a molecular weight of 273.27 g/mol. Its IUPAC name is (2R)-2-(thiadiazole-4-carbonylamino)hexanedioic acid.
| Compound Name | (2R)-2-(thiadiazole-4-carbonylamino)hexanedioic acid |
|---|---|
| PubChem CID | 114006173 |
| Molecular Formula | C9H11N3O5S |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | (2R)-2-(thiadiazole-4-carbonylamino)hexanedioic acid |
| SMILES | O=C(O)CCC[C@@H](NC(=O)c1csnn1)C(=O)O |
| InChI | InChI=1S/C9H11N3O5S/c13-7(14)3-1-2-5(9(16)17)10-8(15)6-4-18-12-11-6/h4-5H,1-3H2,(H,10,15)(H,13,14)(H,16,17)/t5-/m1/s1 |
| InChIKey | YJIPXKDBGZCQTF-RXMQYKEDSA-N |
| XLogP | -0.02 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |