C11H12INO5S — CID 107831442
(2R)-2-[(5-iodothiophene-3-carbonyl)amino]hexanedioic acid (PubChem CID 107831442) has the molecular formula C11H12INO5S and a molecular weight of 397.19 g/mol. Its IUPAC name is (2R)-2-[(5-iodothiophene-3-carbonyl)amino]hexanedioic acid.
| Compound Name | (2R)-2-[(5-iodothiophene-3-carbonyl)amino]hexanedioic acid |
|---|---|
| PubChem CID | 107831442 |
| Molecular Formula | C11H12INO5S |
| Molecular Weight | 397.19 g/mol |
| Exact Mass | 396.95 |
| IUPAC Name | (2R)-2-[(5-iodothiophene-3-carbonyl)amino]hexanedioic acid |
| SMILES | O=C(O)CCC[C@@H](NC(=O)c1csc(I)c1)C(=O)O |
| InChI | InChI=1S/C11H12INO5S/c12-8-4-6(5-19-8)10(16)13-7(11(17)18)2-1-3-9(14)15/h4-5,7H,1-3H2,(H,13,16)(H,14,15)(H,17,18)/t7-/m1/s1 |
| InChIKey | ADNUAHYIRAAQCX-SSDOTTSWSA-N |
| XLogP | 1.79 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|