C10H14INO2S — CID 78948996
5-iodo-N-(4-methoxybutan-2-yl)thiophene-3-carboxamide (PubChem CID 78948996) has the molecular formula C10H14INO2S and a molecular weight of 339.20 g/mol. Its IUPAC name is 5-iodo-N-(4-methoxybutan-2-yl)thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-(4-methoxybutan-2-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 78948996 |
| Molecular Formula | C10H14INO2S |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | 5-iodo-N-(4-methoxybutan-2-yl)thiophene-3-carboxamide |
| SMILES | COCCC(C)NC(=O)c1csc(I)c1 |
| InChI | InChI=1S/C10H14INO2S/c1-7(3-4-14-2)12-10(13)8-5-9(11)15-6-8/h5-7H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | NRKRKPUGYRTESO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|