C9H12INO3S — CID 79693699
N-(2-hydroxy-3-methoxypropyl)-5-iodothiophene-3-carboxamide (PubChem CID 79693699) has the molecular formula C9H12INO3S and a molecular weight of 341.17 g/mol. Its IUPAC name is N-(2-hydroxy-3-methoxypropyl)-5-iodothiophene-3-carboxamide.
| Compound Name | N-(2-hydroxy-3-methoxypropyl)-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 79693699 |
| Molecular Formula | C9H12INO3S |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 340.96 |
| IUPAC Name | N-(2-hydroxy-3-methoxypropyl)-5-iodothiophene-3-carboxamide |
| SMILES | COCC(O)CNC(=O)c1csc(I)c1 |
| InChI | InChI=1S/C9H12INO3S/c1-14-4-7(12)3-11-9(13)6-2-8(10)15-5-6/h2,5,7,12H,3-4H2,1H3,(H,11,13) |
| InChIKey | JRFULRFDZMBCLF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|