C10H15IN2OS — CID 81478928
5-iodo-N-[2-methyl-3-(methylamino)propyl]thiophene-3-carboxamide (PubChem CID 81478928) has the molecular formula C10H15IN2OS and a molecular weight of 338.21 g/mol. Its IUPAC name is 5-iodo-N-[2-methyl-3-(methylamino)propyl]thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-[2-methyl-3-(methylamino)propyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 81478928 |
| Molecular Formula | C10H15IN2OS |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 5-iodo-N-[2-methyl-3-(methylamino)propyl]thiophene-3-carboxamide |
| SMILES | CNCC(C)CNC(=O)c1csc(I)c1 |
| InChI | InChI=1S/C10H15IN2OS/c1-7(4-12-2)5-13-10(14)8-3-9(11)15-6-8/h3,6-7,12H,4-5H2,1-2H3,(H,13,14) |
| InChIKey | PADSMKSREUHWID-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|