C9H14ClIN2OS — CID 120829270
5-iodo-N-[2-(methylamino)propyl]thiophene-3-carboxamide;hydrochloride (PubChem CID 120829270) has the molecular formula C9H14ClIN2OS and a molecular weight of 360.65 g/mol. Its IUPAC name is 5-iodo-N-[2-(methylamino)propyl]thiophene-3-carboxamide;hydrochloride.
| Compound Name | 5-iodo-N-[2-(methylamino)propyl]thiophene-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120829270 |
| Molecular Formula | C9H14ClIN2OS |
| Molecular Weight | 360.65 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | 5-iodo-N-[2-(methylamino)propyl]thiophene-3-carboxamide;hydrochloride |
| SMILES | CNC(C)CNC(=O)c1csc(I)c1.Cl |
| InChI | InChI=1S/C9H13IN2OS.ClH/c1-6(11-2)4-12-9(13)7-3-8(10)14-5-7;/h3,5-6,11H,4H2,1-2H3,(H,12,13);1H |
| InChIKey | UFUHVXLEHFVSBJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.65 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|