C9H13IN2O2S — CID 79693174
N-(2-amino-3-hydroxybutyl)-5-iodothiophene-3-carboxamide (PubChem CID 79693174) has the molecular formula C9H13IN2O2S and a molecular weight of 340.19 g/mol. Its IUPAC name is N-(2-amino-3-hydroxybutyl)-5-iodothiophene-3-carboxamide.
| Compound Name | N-(2-amino-3-hydroxybutyl)-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 79693174 |
| Molecular Formula | C9H13IN2O2S |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | N-(2-amino-3-hydroxybutyl)-5-iodothiophene-3-carboxamide |
| SMILES | CC(O)C(N)CNC(=O)c1csc(I)c1 |
| InChI | InChI=1S/C9H13IN2O2S/c1-5(13)7(11)3-12-9(14)6-2-8(10)15-4-6/h2,4-5,7,13H,3,11H2,1H3,(H,12,14) |
| InChIKey | JAUXIPUVYNUSEV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|