C11H15IN2O2 — CID 64539149
N-(2-amino-3-hydroxybutyl)-3-iodobenzamide (PubChem CID 64539149) has the molecular formula C11H15IN2O2 and a molecular weight of 334.16 g/mol. Its IUPAC name is N-(2-amino-3-hydroxybutyl)-3-iodobenzamide.
| Compound Name | N-(2-amino-3-hydroxybutyl)-3-iodobenzamide |
|---|---|
| PubChem CID | 64539149 |
| Molecular Formula | C11H15IN2O2 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | N-(2-amino-3-hydroxybutyl)-3-iodobenzamide |
| SMILES | CC(O)C(N)CNC(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C11H15IN2O2/c1-7(15)10(13)6-14-11(16)8-3-2-4-9(12)5-8/h2-5,7,10,15H,6,13H2,1H3,(H,14,16) |
| InChIKey | CRJLJYLDDIEAHC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|