C12H15ClINO — CID 114306257
N-(4-chloro-2-methylbutyl)-3-iodobenzamide (PubChem CID 114306257) has the molecular formula C12H15ClINO and a molecular weight of 351.62 g/mol. Its IUPAC name is N-(4-chloro-2-methylbutyl)-3-iodobenzamide.
| Compound Name | N-(4-chloro-2-methylbutyl)-3-iodobenzamide |
|---|---|
| PubChem CID | 114306257 |
| Molecular Formula | C12H15ClINO |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | N-(4-chloro-2-methylbutyl)-3-iodobenzamide |
| SMILES | CC(CCCl)CNC(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C12H15ClINO/c1-9(5-6-13)8-15-12(16)10-3-2-4-11(14)7-10/h2-4,7,9H,5-6,8H2,1H3,(H,15,16) |
| InChIKey | OQKKLEKJEHOIQJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|